C22H21N3O4 — CID 46543764
4-(2,5-dioxopyrrolidin-1-yl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 46543764) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46543764 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N1CCCC1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C22H21N3O4/c26-19-11-12-20(27)25(19)16-9-7-15(8-10-16)21(28)23-18-6-2-1-5-17(18)22(29)24-13-3-4-14-24/h1-2,5-10H,3-4,11-14H2,(H,23,28) |
| InChIKey | RFJVGOWRMYGSJV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|