C21H21N3O3 — CID 16557741
4-(2,5-dioxopyrrolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)benzamide (PubChem CID 16557741) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)benzamide.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 16557741 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-N-(2-pyrrolidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1N1CCCC1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C21H21N3O3/c25-19-11-12-20(26)24(19)16-9-7-15(8-10-16)21(27)22-17-5-1-2-6-18(17)23-13-3-4-14-23/h1-2,5-10H,3-4,11-14H2,(H,22,27) |
| InChIKey | GNBXPEGTNBBQOK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|