C20H22N2O3 — CID 42888700
N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]benzamide (PubChem CID 42888700) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]benzamide.
| Compound Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42888700 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]benzamide |
| SMILES | CC1CN(C(=O)c2ccccc2NC(=O)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C20H22N2O3/c1-14-12-22(13-15(2)25-14)20(24)17-10-6-7-11-18(17)21-19(23)16-8-4-3-5-9-16/h3-11,14-15H,12-13H2,1-2H3,(H,21,23) |
| InChIKey | WFAWCFBALCZZKW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |