C21H23N3O5 — CID 42944721
N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3-methyl-4-nitrobenzamide (PubChem CID 42944721) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 42944721 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholine-4-carbonyl)phenyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2C(=O)N2CC(C)OC(C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N3O5/c1-13-10-16(8-9-19(13)24(27)28)20(25)22-18-7-5-4-6-17(18)21(26)23-11-14(2)29-15(3)12-23/h4-10,14-15H,11-12H2,1-3H3,(H,22,25) |
| InChIKey | RFBYXDFPBIKQBF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|