C15H14N2O5 — CID 110691213
dimethyl 2-(1H-pyrrole-3-carbonylamino)benzene-1,4-dicarboxylate (PubChem CID 110691213) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is dimethyl 2-(1H-pyrrole-3-carbonylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(1H-pyrrole-3-carbonylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 110691213 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | dimethyl 2-(1H-pyrrole-3-carbonylamino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)c2cc[nH]c2)c1 |
| InChI | InChI=1S/C15H14N2O5/c1-21-14(19)9-3-4-11(15(20)22-2)12(7-9)17-13(18)10-5-6-16-8-10/h3-8,16H,1-2H3,(H,17,18) |
| InChIKey | XIUDPBVFIGQJBP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |