About ethane;methyl 1H-pyrrole-3-carboxylate
ethane;methyl 1H-pyrrole-3-carboxylate (PubChem CID 169144888) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is ethane;methyl 1H-pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethane;methyl 1H-pyrrole-3-carboxylate |
| PubChem CID | 169144888 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | ethane;methyl 1H-pyrrole-3-carboxylate |
| SMILES | CC.COC(=O)c1cc[nH]c1 |
| InChI | InChI=1S/C6H7NO2.C2H6/c1-9-6(8)5-2-3-7-4-5;1-2/h2-4,7H,1H3;1-2H3 |
| InChIKey | VIKMOFUTMUHROX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methyl 1H-pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 1H-pyrrole-3-carboxylate?
The IUPAC name of ethane;methyl 1H-pyrrole-3-carboxylate (CID 169144888) is ethane;methyl 1H-pyrrole-3-carboxylate.
What is the SMILES notation for ethane;methyl 1H-pyrrole-3-carboxylate?
The canonical SMILES for ethane;methyl 1H-pyrrole-3-carboxylate is CC.COC(=O)c1cc[nH]c1.
What is the InChIKey of ethane;methyl 1H-pyrrole-3-carboxylate?
The InChIKey is VIKMOFUTMUHROX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.C2H6/c1-9-6(8)5-2-3-7-4-5;1-2/h2-4,7H,1H3;1-2H3.
What are the key properties of ethane;methyl 1H-pyrrole-3-carboxylate?
ethane;methyl 1H-pyrrole-3-carboxylate has a molecular weight of 155.20 g/mol, XLogP of 1.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 1H-pyrrole-3-carboxylate is sourced from PubChem (CID 169144888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).