C24H20ClN3O3 — CID 53135565
N-(3-chlorophenyl)-4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]benzamide (PubChem CID 53135565) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(3-chlorophenyl)-4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 53135565 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(2,3-dioxo-4-phenylpiperazin-1-yl)methyl]benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(CN2CCN(c3ccccc3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C24H20ClN3O3/c25-19-5-4-6-20(15-19)26-22(29)18-11-9-17(10-12-18)16-27-13-14-28(24(31)23(27)30)21-7-2-1-3-8-21/h1-12,15H,13-14,16H2,(H,26,29) |
| InChIKey | XVCHJQYASMDESB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|