C19H17ClN2O4 — CID 53214174
4-[[4-[(3-chlorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]benzoic acid (PubChem CID 53214174) has the molecular formula C19H17ClN2O4 and a molecular weight of 372.81 g/mol. Its IUPAC name is 4-[[4-[(3-chlorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[(3-chlorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 53214174 |
| Molecular Formula | C19H17ClN2O4 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[[4-[(3-chlorophenyl)methyl]-2,3-dioxopiperazin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCN(Cc3cccc(Cl)c3)C(=O)C2=O)cc1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-16-3-1-2-14(10-16)12-22-9-8-21(17(23)18(22)24)11-13-4-6-15(7-5-13)19(25)26/h1-7,10H,8-9,11-12H2,(H,25,26) |
| InChIKey | NBRKWHQJHQDWDW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|