C19H20ClNO2 — CID 122033759
4-[[4-(3-chlorophenyl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 122033759) has the molecular formula C19H20ClNO2 and a molecular weight of 329.83 g/mol. Its IUPAC name is 4-[[4-(3-chlorophenyl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(3-chlorophenyl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122033759 |
| Molecular Formula | C19H20ClNO2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-[[4-(3-chlorophenyl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H20ClNO2/c20-18-3-1-2-17(12-18)15-8-10-21(11-9-15)13-14-4-6-16(7-5-14)19(22)23/h1-7,12,15H,8-11,13H2,(H,22,23) |
| InChIKey | XHSABEUBAJNBBC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |