C18H21ClN2O — CID 99942167
1-[5-[[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]methyl]-1-methylpyrrol-3-yl]ethanone (PubChem CID 99942167) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 1-[5-[[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]methyl]-1-methylpyrrol-3-yl]ethanone.
| Compound Name | 1-[5-[[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]methyl]-1-methylpyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 99942167 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-[5-[[(3S)-3-(3-chlorophenyl)pyrrolidin-1-yl]methyl]-1-methylpyrrol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CC[C@@H](c3cccc(Cl)c3)C2)n(C)c1 |
| InChI | InChI=1S/C18H21ClN2O/c1-13(22)16-9-18(20(2)10-16)12-21-7-6-15(11-21)14-4-3-5-17(19)8-14/h3-5,8-10,15H,6-7,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | SKLUWNWTIBNWIM-OAHLLOKOSA-N |
| XLogP | 3.87 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |