C20H24ClNO3 — CID 77086698
3-(3-chlorophenyl)-1-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine (PubChem CID 77086698) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine.
| Compound Name | 3-(3-chlorophenyl)-1-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 77086698 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(2,4,6-trimethoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1cc(OC)c(CN2CCC(c3cccc(Cl)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H24ClNO3/c1-23-17-10-19(24-2)18(20(11-17)25-3)13-22-8-7-15(12-22)14-5-4-6-16(21)9-14/h4-6,9-11,15H,7-8,12-13H2,1-3H3 |
| InChIKey | MCYWUYSLICNTDS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |