C22H31ClN2O — CID 164906429
4-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propoxy]-N-methylaniline;ethane (PubChem CID 164906429) has the molecular formula C22H31ClN2O and a molecular weight of 374.96 g/mol. Its IUPAC name is 4-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propoxy]-N-methylaniline;ethane.
| Compound Name | 4-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propoxy]-N-methylaniline;ethane |
|---|---|
| PubChem CID | 164906429 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-[3-[3-(3-chlorophenyl)pyrrolidin-1-yl]propoxy]-N-methylaniline;ethane |
| SMILES | CC.CNc1ccc(OCCCN2CCC(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C20H25ClN2O.C2H6/c1-22-19-6-8-20(9-7-19)24-13-3-11-23-12-10-17(15-23)16-4-2-5-18(21)14-16;1-2/h2,4-9,14,17,22H,3,10-13,15H2,1H3;1-2H3 |
| InChIKey | ONTIINPVZJOCFB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|