C22H29ClN2O — CID 164906527
4-[3-[3-(3-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]propoxy]-N-methylaniline (PubChem CID 164906527) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is 4-[3-[3-(3-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]propoxy]-N-methylaniline.
| Compound Name | 4-[3-[3-(3-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]propoxy]-N-methylaniline |
|---|---|
| PubChem CID | 164906527 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-[3-[3-(3-chlorophenyl)-2,2-dimethylpyrrolidin-1-yl]propoxy]-N-methylaniline |
| SMILES | CNc1ccc(OCCCN2CCC(c3cccc(Cl)c3)C2(C)C)cc1 |
| InChI | InChI=1S/C22H29ClN2O/c1-22(2)21(17-6-4-7-18(23)16-17)12-14-25(22)13-5-15-26-20-10-8-19(24-3)9-11-20/h4,6-11,16,21,24H,5,12-15H2,1-3H3 |
| InChIKey | CIVWPSDFPUWQKT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|