C24H34N2O3S — CID 164906204
N-[4-[3-[2,2-dimethyl-3-(3-methylphenyl)pyrrolidin-1-yl]propoxy]phenyl]-N-methylmethanesulfonamide (PubChem CID 164906204) has the molecular formula C24H34N2O3S and a molecular weight of 430.61 g/mol. Its IUPAC name is N-[4-[3-[2,2-dimethyl-3-(3-methylphenyl)pyrrolidin-1-yl]propoxy]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[3-[2,2-dimethyl-3-(3-methylphenyl)pyrrolidin-1-yl]propoxy]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 164906204 |
| Molecular Formula | C24H34N2O3S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[4-[3-[2,2-dimethyl-3-(3-methylphenyl)pyrrolidin-1-yl]propoxy]phenyl]-N-methylmethanesulfonamide |
| SMILES | Cc1cccc(C2CCN(CCCOc3ccc(N(C)S(C)(=O)=O)cc3)C2(C)C)c1 |
| InChI | InChI=1S/C24H34N2O3S/c1-19-8-6-9-20(18-19)23-14-16-26(24(23,2)3)15-7-17-29-22-12-10-21(11-13-22)25(4)30(5,27)28/h6,8-13,18,23H,7,14-17H2,1-5H3 |
| InChIKey | NAPKBXAYLLJMKJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|