C22H29NO4S — CID 19803901
[1-[3-(3-methylphenoxy)propyl]piperidin-2-yl]methyl benzenesulfonate (PubChem CID 19803901) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is [1-[3-(3-methylphenoxy)propyl]piperidin-2-yl]methyl benzenesulfonate.
| Compound Name | [1-[3-(3-methylphenoxy)propyl]piperidin-2-yl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 19803901 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [1-[3-(3-methylphenoxy)propyl]piperidin-2-yl]methyl benzenesulfonate |
| SMILES | Cc1cccc(OCCCN2CCCCC2COS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H29NO4S/c1-19-9-7-11-21(17-19)26-16-8-15-23-14-6-5-10-20(23)18-27-28(24,25)22-12-3-2-4-13-22/h2-4,7,9,11-13,17,20H,5-6,8,10,14-16,18H2,1H3 |
| InChIKey | PHDOBHXGFLPPQP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|