C15H21NO3 — CID 43441222
1-[2-(3-methylphenoxy)ethyl]piperidine-2-carboxylic acid (PubChem CID 43441222) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-(3-methylphenoxy)ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(3-methylphenoxy)ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43441222 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[2-(3-methylphenoxy)ethyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cccc(OCCN2CCCCC2C(=O)O)c1 |
| InChI | InChI=1S/C15H21NO3/c1-12-5-4-6-13(11-12)19-10-9-16-8-3-2-7-14(16)15(17)18/h4-6,11,14H,2-3,7-10H2,1H3,(H,17,18) |
| InChIKey | WPTUWLBEQYGIFN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |