C18H25NO3 — CID 125143929
(2S,3aR,7aR)-1-[2-(3-methylphenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125143929) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2S,3aR,7aR)-1-[2-(3-methylphenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aR)-1-[2-(3-methylphenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125143929 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2S,3aR,7aR)-1-[2-(3-methylphenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | Cc1cccc(OCCN2[C@@H]3CCCC[C@@H]3C[C@H]2C(=O)O)c1 |
| InChI | InChI=1S/C18H25NO3/c1-13-5-4-7-15(11-13)22-10-9-19-16-8-3-2-6-14(16)12-17(19)18(20)21/h4-5,7,11,14,16-17H,2-3,6,8-10,12H2,1H3,(H,20,21)/t14-,16-,17+/m1/s1 |
| InChIKey | CWGOMPYMWZMNFD-OIISXLGYSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |