C17H23NO4 — CID 119355758
1-[5-(3-methylphenoxy)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119355758) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[5-(3-methylphenoxy)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[5-(3-methylphenoxy)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119355758 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1-[5-(3-methylphenoxy)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc(OCCCCC(=O)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C17H23NO4/c1-13-6-4-7-14(12-13)22-11-3-2-9-16(19)18-10-5-8-15(18)17(20)21/h4,6-7,12,15H,2-3,5,8-11H2,1H3,(H,20,21) |
| InChIKey | ZGLMZJJTXHDQNG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|