C24H30N2O5 — CID 163225404
1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid;toluene (PubChem CID 163225404) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid;toluene.
| Compound Name | 1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid;toluene |
|---|---|
| PubChem CID | 163225404 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 1-[2-(4-phenoxybutanoylamino)acetyl]pyrrolidine-2-carboxylic acid;toluene |
| SMILES | Cc1ccccc1.O=C(CCCOc1ccccc1)NCC(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C17H22N2O5.C7H8/c20-15(9-5-11-24-13-6-2-1-3-7-13)18-12-16(21)19-10-4-8-14(19)17(22)23;1-7-5-3-2-4-6-7/h1-3,6-7,14H,4-5,8-12H2,(H,18,20)(H,22,23);2-6H,1H3 |
| InChIKey | LKUYAOKQBBVZOJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|