C17H21F3N2O3 — CID 55600518
1-(4-phenoxybutanoyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 55600518) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 1-(4-phenoxybutanoyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-phenoxybutanoyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55600518 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(4-phenoxybutanoyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN1C(=O)CCCOc1ccccc1 |
| InChI | InChI=1S/C17H21F3N2O3/c18-17(19,20)12-21-16(24)14-8-4-10-22(14)15(23)9-5-11-25-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,21,24) |
| InChIKey | QRYWLADSEIBBTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|