C17H22FNO3 — CID 125148825
(2S,3aR,7aS)-1-[2-(4-fluorophenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 125148825) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-[2-(4-fluorophenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S,3aR,7aS)-1-[2-(4-fluorophenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 125148825 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2S,3aR,7aS)-1-[2-(4-fluorophenoxy)ethyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2CCCC[C@@H]2N1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C17H22FNO3/c18-13-5-7-14(8-6-13)22-10-9-19-15-4-2-1-3-12(15)11-16(19)17(20)21/h5-8,12,15-16H,1-4,9-11H2,(H,20,21)/t12-,15+,16+/m1/s1 |
| InChIKey | OCCDXRINFYMWTQ-KCXAZCMYSA-N |
| XLogP | 2.92 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |