C13H20F3NO3 — CID 66471734
1-[2-(trifluoromethoxy)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid (PubChem CID 66471734) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-[2-(trifluoromethoxy)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-[2-(trifluoromethoxy)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 66471734 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[2-(trifluoromethoxy)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)C1CCC2CCCCC2N1CCOC(F)(F)F |
| InChI | InChI=1S/C13H20F3NO3/c14-13(15,16)20-8-7-17-10-4-2-1-3-9(10)5-6-11(17)12(18)19/h9-11H,1-8H2,(H,18,19) |
| InChIKey | IMEKUWSBFFKMGN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |