C15H19Br2NO2S — CID 102845160
1-[(4,5-dibromothiophen-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid (PubChem CID 102845160) has the molecular formula C15H19Br2NO2S and a molecular weight of 437.20 g/mol. Its IUPAC name is 1-[(4,5-dibromothiophen-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-[(4,5-dibromothiophen-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 102845160 |
| Molecular Formula | C15H19Br2NO2S |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 434.95 |
| IUPAC Name | 1-[(4,5-dibromothiophen-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-2-carboxylic acid |
| SMILES | O=C(O)C1CCC2CCCCC2N1Cc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H19Br2NO2S/c16-11-7-10(21-14(11)17)8-18-12-4-2-1-3-9(12)5-6-13(18)15(19)20/h7,9,12-13H,1-6,8H2,(H,19,20) |
| InChIKey | LVRJIJCIRUHRGO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |