C14H17Br2NO2S — CID 102845157
1-[(4,5-dibromothiophen-2-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 102845157) has the molecular formula C14H17Br2NO2S and a molecular weight of 423.17 g/mol. Its IUPAC name is 1-[(4,5-dibromothiophen-2-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-[(4,5-dibromothiophen-2-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 102845157 |
| Molecular Formula | C14H17Br2NO2S |
| Molecular Weight | 423.17 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 1-[(4,5-dibromothiophen-2-yl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCCCC2N1Cc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H17Br2NO2S/c15-10-6-9(20-13(10)16)7-17-11-4-2-1-3-8(11)5-12(17)14(18)19/h6,8,11-12H,1-5,7H2,(H,18,19) |
| InChIKey | VUTZGSNIONFIAG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |