C21H27NO6S — CID 19804102
[1-[2-(3,4-dimethoxyphenoxy)ethyl]pyrrolidin-2-yl]methyl benzenesulfonate (PubChem CID 19804102) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is [1-[2-(3,4-dimethoxyphenoxy)ethyl]pyrrolidin-2-yl]methyl benzenesulfonate.
| Compound Name | [1-[2-(3,4-dimethoxyphenoxy)ethyl]pyrrolidin-2-yl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 19804102 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [1-[2-(3,4-dimethoxyphenoxy)ethyl]pyrrolidin-2-yl]methyl benzenesulfonate |
| SMILES | COc1ccc(OCCN2CCCC2COS(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H27NO6S/c1-25-20-11-10-18(15-21(20)26-2)27-14-13-22-12-6-7-17(22)16-28-29(23,24)19-8-4-3-5-9-19/h3-5,8-11,15,17H,6-7,12-14,16H2,1-2H3 |
| InChIKey | YZUKSGNQZWEPFK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|