C32H37NO6 — CID 22909594
(E)-but-2-enedioic acid;1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,2-diphenylethyl)pyrrolidine (PubChem CID 22909594) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,2-diphenylethyl)pyrrolidine.
| Compound Name | (E)-but-2-enedioic acid;1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,2-diphenylethyl)pyrrolidine |
|---|---|
| PubChem CID | 22909594 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[2-(3,4-dimethoxyphenyl)ethyl]-2-(2,2-diphenylethyl)pyrrolidine |
| SMILES | COc1ccc(CCN2CCCC2CC(c2ccccc2)c2ccccc2)cc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H33NO2.C4H4O4/c1-30-27-16-15-22(20-28(27)31-2)17-19-29-18-9-14-25(29)21-26(23-10-5-3-6-11-23)24-12-7-4-8-13-24;5-3(6)1-2-4(7)8/h3-8,10-13,15-16,20,25-26H,9,14,17-19,21H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ROOOUNSOBUWJLO-WLHGVMLRSA-N |
| XLogP | 5.64 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|