C17H25NO4 — CID 141241691
methyl 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxylate (PubChem CID 141241691) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxylate.
| Compound Name | methyl 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 141241691 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(CCc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C17H25NO4/c1-20-15-7-6-13(11-16(15)21-2)8-10-18-9-4-5-14(12-18)17(19)22-3/h6-7,11,14H,4-5,8-10,12H2,1-3H3 |
| InChIKey | XGTNKCBSJUMHLB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |