C24H31FN2O3 — CID 46765225
N-[3-(3,4-dimethoxyphenyl)propyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 46765225) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46765225 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-1-[(4-fluorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCCNC(=O)C2CCCN(Cc3ccc(F)cc3)C2)cc1OC |
| InChI | InChI=1S/C24H31FN2O3/c1-29-22-12-9-18(15-23(22)30-2)5-3-13-26-24(28)20-6-4-14-27(17-20)16-19-7-10-21(25)11-8-19/h7-12,15,20H,3-6,13-14,16-17H2,1-2H3,(H,26,28) |
| InChIKey | WAEAEXDVFYBTCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|