C22H26ClFN2O — CID 94020473
(3S)-1-[(2-chlorophenyl)methyl]-N-[3-(4-fluorophenyl)propyl]piperidine-3-carboxamide (PubChem CID 94020473) has the molecular formula C22H26ClFN2O and a molecular weight of 388.91 g/mol. Its IUPAC name is (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(4-fluorophenyl)propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(4-fluorophenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94020473 |
| Molecular Formula | C22H26ClFN2O |
| Molecular Weight | 388.91 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (3S)-1-[(2-chlorophenyl)methyl]-N-[3-(4-fluorophenyl)propyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCCc1ccc(F)cc1)[C@H]1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H26ClFN2O/c23-21-8-2-1-6-18(21)15-26-14-4-7-19(16-26)22(27)25-13-3-5-17-9-11-20(24)12-10-17/h1-2,6,8-12,19H,3-5,7,13-16H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | BQSDCLTZGGACHC-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|