C25H33ClN2O — CID 132664361
1-[(2-chlorophenyl)methyl]-N-[3-(4-propan-2-ylphenyl)propyl]piperidine-3-carboxamide (PubChem CID 132664361) has the molecular formula C25H33ClN2O and a molecular weight of 413.01 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-[3-(4-propan-2-ylphenyl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-[3-(4-propan-2-ylphenyl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 132664361 |
| Molecular Formula | C25H33ClN2O |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-[3-(4-propan-2-ylphenyl)propyl]piperidine-3-carboxamide |
| SMILES | CC(C)c1ccc(CCCNC(=O)C2CCCN(Cc3ccccc3Cl)C2)cc1 |
| InChI | InChI=1S/C25H33ClN2O/c1-19(2)21-13-11-20(12-14-21)7-5-15-27-25(29)23-9-6-16-28(18-23)17-22-8-3-4-10-24(22)26/h3-4,8,10-14,19,23H,5-7,9,15-18H2,1-2H3,(H,27,29) |
| InChIKey | DDQLKWIJCFYCLA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|