C21H29ClN2O — CID 93491776
(3R)-1-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide (PubChem CID 93491776) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is (3R)-1-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93491776 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (3R)-1-[(2-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)[C@@H]1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C21H29ClN2O/c22-20-11-5-4-9-18(20)15-24-14-6-10-19(16-24)21(25)23-13-12-17-7-2-1-3-8-17/h4-5,7,9,11,19H,1-3,6,8,10,12-16H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | RJWKTRWFUQLKJA-LJQANCHMSA-N |
| XLogP | 4.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|