C21H28Cl2N2O — CID 93491780
(3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 93491780) has the molecular formula C21H28Cl2N2O and a molecular weight of 395.37 g/mol. Its IUPAC name is (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93491780 |
| Molecular Formula | C21H28Cl2N2O |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (3R)-N-[2-(cyclohexen-1-yl)ethyl]-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)[C@@H]1CCCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C21H28Cl2N2O/c22-19-9-4-10-20(23)18(19)15-25-13-5-8-17(14-25)21(26)24-12-11-16-6-2-1-3-7-16/h4,6,9-10,17H,1-3,5,7-8,11-15H2,(H,24,26)/t17-/m1/s1 |
| InChIKey | ATBZRDLPMIOCSX-QGZVFWFLSA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|