C21H24Cl2N2OS — CID 43920631
1-[(2,6-dichlorophenyl)methyl]-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide (PubChem CID 43920631) has the molecular formula C21H24Cl2N2OS and a molecular weight of 423.41 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920631 |
| Molecular Formula | C21H24Cl2N2OS |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-N-(2-phenylsulfanylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)C1CCCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C21H24Cl2N2OS/c22-19-9-4-10-20(23)18(19)15-25-12-5-6-16(14-25)21(26)24-11-13-27-17-7-2-1-3-8-17/h1-4,7-10,16H,5-6,11-15H2,(H,24,26) |
| InChIKey | XAMUZROLZXXIIC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|