C19H28Cl2N2O2 — CID 93492205
(3R)-1-[(2,6-dichlorophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide (PubChem CID 93492205) has the molecular formula C19H28Cl2N2O2 and a molecular weight of 387.35 g/mol. Its IUPAC name is (3R)-1-[(2,6-dichlorophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(2,6-dichlorophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93492205 |
| Molecular Formula | C19H28Cl2N2O2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (3R)-1-[(2,6-dichlorophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)[C@@H]1CCCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C19H28Cl2N2O2/c1-14(2)25-11-5-9-22-19(24)15-6-4-10-23(12-15)13-16-17(20)7-3-8-18(16)21/h3,7-8,14-15H,4-6,9-13H2,1-2H3,(H,22,24)/t15-/m1/s1 |
| InChIKey | PEAMTKRYZYRZME-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|