C19H29BrN2O2 — CID 43924508
1-[(3-bromophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide (PubChem CID 43924508) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43924508 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-(3-propan-2-yloxypropyl)piperidine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)C1CCCN(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C19H29BrN2O2/c1-15(2)24-11-5-9-21-19(23)17-7-4-10-22(14-17)13-16-6-3-8-18(20)12-16/h3,6,8,12,15,17H,4-5,7,9-11,13-14H2,1-2H3,(H,21,23) |
| InChIKey | XKHOEDWCEVJIGP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|