C21H31BrN2O — CID 43925877
1-[(3-bromophenyl)methyl]-N-cyclooctylpiperidine-3-carboxamide (PubChem CID 43925877) has the molecular formula C21H31BrN2O and a molecular weight of 407.40 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-cyclooctylpiperidine-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-cyclooctylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43925877 |
| Molecular Formula | C21H31BrN2O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-cyclooctylpiperidine-3-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCCN(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C21H31BrN2O/c22-19-10-6-8-17(14-19)15-24-13-7-9-18(16-24)21(25)23-20-11-4-2-1-3-5-12-20/h6,8,10,14,18,20H,1-5,7,9,11-13,15-16H2,(H,23,25) |
| InChIKey | HEUUZTLNEYUPLQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |