C19H20Br2N2O — CID 43919496
N-(3-bromophenyl)-1-[(4-bromophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43919496) has the molecular formula C19H20Br2N2O and a molecular weight of 452.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-[(4-bromophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-1-[(4-bromophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43919496 |
| Molecular Formula | C19H20Br2N2O |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | N-(3-bromophenyl)-1-[(4-bromophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)C1CCCN(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H20Br2N2O/c20-16-8-6-14(7-9-16)12-23-10-2-3-15(13-23)19(24)22-18-5-1-4-17(21)11-18/h1,4-9,11,15H,2-3,10,12-13H2,(H,22,24) |
| InChIKey | RPYOOOUHCGEYNI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |