C26H28N4O2 — CID 47074842
1-benzyl-N-[3-(phenylcarbamoylamino)phenyl]piperidine-3-carboxamide (PubChem CID 47074842) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 1-benzyl-N-[3-(phenylcarbamoylamino)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[3-(phenylcarbamoylamino)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47074842 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-benzyl-N-[3-(phenylcarbamoylamino)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(NC(=O)C2CCCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C26H28N4O2/c31-25(21-11-8-16-30(19-21)18-20-9-3-1-4-10-20)27-23-14-7-15-24(17-23)29-26(32)28-22-12-5-2-6-13-22/h1-7,9-10,12-15,17,21H,8,11,16,18-19H2,(H,27,31)(H2,28,29,32) |
| InChIKey | JMSBPJXVSNBOCI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |