C21H26N2O — CID 93490442
(3S)-1-benzyl-N-(3,4-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 93490442) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (3S)-1-benzyl-N-(3,4-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-benzyl-N-(3,4-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93490442 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (3S)-1-benzyl-N-(3,4-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCCN(Cc3ccccc3)C2)cc1C |
| InChI | InChI=1S/C21H26N2O/c1-16-10-11-20(13-17(16)2)22-21(24)19-9-6-12-23(15-19)14-18-7-4-3-5-8-18/h3-5,7-8,10-11,13,19H,6,9,12,14-15H2,1-2H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | GMWZMDJDKHMIGC-IBGZPJMESA-N |
| XLogP | 4.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |