C19H21ClN2O — CID 93490525
(3R)-1-benzyl-N-(3-chlorophenyl)piperidine-3-carboxamide (PubChem CID 93490525) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is (3R)-1-benzyl-N-(3-chlorophenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-benzyl-N-(3-chlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93490525 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (3R)-1-benzyl-N-(3-chlorophenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)[C@@H]1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H21ClN2O/c20-17-9-4-10-18(12-17)21-19(23)16-8-5-11-22(14-16)13-15-6-2-1-3-7-15/h1-4,6-7,9-10,12,16H,5,8,11,13-14H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | XGQXFKQBXIEUOU-MRXNPFEDSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |