C20H23BrN2O — CID 43919529
N-(4-bromophenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 43919529) has the molecular formula C20H23BrN2O and a molecular weight of 387.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(4-bromophenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43919529 |
| Molecular Formula | C20H23BrN2O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(4-bromophenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CN2CCCC(C(=O)Nc3ccc(Br)cc3)C2)cc1 |
| InChI | InChI=1S/C20H23BrN2O/c1-15-4-6-16(7-5-15)13-23-12-2-3-17(14-23)20(24)22-19-10-8-18(21)9-11-19/h4-11,17H,2-3,12-14H2,1H3,(H,22,24) |
| InChIKey | QMQTZYKVZJNUEF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |