C20H22BrClN2O — CID 43921604
1-[(4-bromophenyl)methyl]-N-(5-chloro-2-methylphenyl)piperidine-3-carboxamide (PubChem CID 43921604) has the molecular formula C20H22BrClN2O and a molecular weight of 421.77 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-(5-chloro-2-methylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-(5-chloro-2-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43921604 |
| Molecular Formula | C20H22BrClN2O |
| Molecular Weight | 421.77 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-(5-chloro-2-methylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C1CCCN(Cc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C20H22BrClN2O/c1-14-4-9-18(22)11-19(14)23-20(25)16-3-2-10-24(13-16)12-15-5-7-17(21)8-6-15/h4-9,11,16H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | XAFXWVCPWWQHGW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |