C20H22ClIN2O — CID 43923845
1-[(4-chlorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-3-carboxamide (PubChem CID 43923845) has the molecular formula C20H22ClIN2O and a molecular weight of 468.77 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43923845 |
| Molecular Formula | C20H22ClIN2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1CCCN(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H22ClIN2O/c1-14-11-18(22)8-9-19(14)23-20(25)16-3-2-10-24(13-16)12-15-4-6-17(21)7-5-15/h4-9,11,16H,2-3,10,12-13H2,1H3,(H,23,25) |
| InChIKey | MGSDOVCOCXJCRO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|