C21H25IN2O — CID 43923842
N-(4-iodo-2-methylphenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 43923842) has the molecular formula C21H25IN2O and a molecular weight of 448.35 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43923842 |
| Molecular Formula | C21H25IN2O |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-1-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(CN2CCCC(C(=O)Nc3ccc(I)cc3C)C2)cc1 |
| InChI | InChI=1S/C21H25IN2O/c1-15-5-7-17(8-6-15)13-24-11-3-4-18(14-24)21(25)23-20-10-9-19(22)12-16(20)2/h5-10,12,18H,3-4,11,13-14H2,1-2H3,(H,23,25) |
| InChIKey | GVAIAQHGITUWCX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|