C20H22FIN2O — CID 45014317
1-[(4-fluorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-4-carboxamide (PubChem CID 45014317) has the molecular formula C20H22FIN2O and a molecular weight of 452.31 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45014317 |
| Molecular Formula | C20H22FIN2O |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-(4-iodo-2-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FIN2O/c1-14-12-18(22)6-7-19(14)23-20(25)16-8-10-24(11-9-16)13-15-2-4-17(21)5-3-15/h2-7,12,16H,8-11,13H2,1H3,(H,23,25) |
| InChIKey | WSOHRRRARGAMKL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|