C20H27BrN2O — CID 43921297
N-(2-bicyclo[2.2.1]heptanyl)-1-[(3-bromophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43921297) has the molecular formula C20H27BrN2O and a molecular weight of 391.35 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanyl)-1-[(3-bromophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanyl)-1-[(3-bromophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43921297 |
| Molecular Formula | C20H27BrN2O |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanyl)-1-[(3-bromophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NC1CC2CCC1C2)C1CCCN(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C20H27BrN2O/c21-18-5-1-3-15(10-18)12-23-8-2-4-17(13-23)20(24)22-19-11-14-6-7-16(19)9-14/h1,3,5,10,14,16-17,19H,2,4,6-9,11-13H2,(H,22,24) |
| InChIKey | DNWKWGOMGBMAGF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |