C21H25BrN2O3 — CID 43920046
1-[(3-bromophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide (PubChem CID 43920046) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920046 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2CCCN(Cc3cccc(Br)c3)C2)c1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-26-18-8-9-20(27-2)19(12-18)23-21(25)16-6-4-10-24(14-16)13-15-5-3-7-17(22)11-15/h3,5,7-9,11-12,16H,4,6,10,13-14H2,1-2H3,(H,23,25) |
| InChIKey | DNSFZUOSCIZKQC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |