C25H25BrN2OS — CID 43924958
1-[(3-bromophenyl)methyl]-N-(2-phenylsulfanylphenyl)piperidine-3-carboxamide (PubChem CID 43924958) has the molecular formula C25H25BrN2OS and a molecular weight of 481.46 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-(2-phenylsulfanylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-(2-phenylsulfanylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43924958 |
| Molecular Formula | C25H25BrN2OS |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-(2-phenylsulfanylphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Sc1ccccc1)C1CCCN(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C25H25BrN2OS/c26-21-10-6-8-19(16-21)17-28-15-7-9-20(18-28)25(29)27-23-13-4-5-14-24(23)30-22-11-2-1-3-12-22/h1-6,8,10-14,16,20H,7,9,15,17-18H2,(H,27,29) |
| InChIKey | FEUGLHAMWVTENN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |