C23H26BrN3O2 — CID 43923607
1-[(3-bromophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide (PubChem CID 43923607) has the molecular formula C23H26BrN3O2 and a molecular weight of 456.38 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43923607 |
| Molecular Formula | C23H26BrN3O2 |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-[2-(prop-2-enylcarbamoyl)phenyl]piperidine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)C1CCCN(Cc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C23H26BrN3O2/c1-2-12-25-23(29)20-10-3-4-11-21(20)26-22(28)18-8-6-13-27(16-18)15-17-7-5-9-19(24)14-17/h2-5,7,9-11,14,18H,1,6,8,12-13,15-16H2,(H,25,29)(H,26,28) |
| InChIKey | RXLASPUPSLZQQG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|