C21H24Cl2N2O3 — CID 43920044
1-[(3,4-dichlorophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide (PubChem CID 43920044) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43920044 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-(2,5-dimethoxyphenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C2CCCN(Cc3ccc(Cl)c(Cl)c3)C2)c1 |
| InChI | InChI=1S/C21H24Cl2N2O3/c1-27-16-6-8-20(28-2)19(11-16)24-21(26)15-4-3-9-25(13-15)12-14-5-7-17(22)18(23)10-14/h5-8,10-11,15H,3-4,9,12-13H2,1-2H3,(H,24,26) |
| InChIKey | QJIBVMVWWCRWQO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |